About 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one
1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one (PubChem CID 118680503) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one |
| PubChem CID | 118680503 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one |
| SMILES | CCC1CC=CC=C1n1cc(C)ccc1=O |
| InChI | InChI=1S/C14H17NO/c1-3-12-6-4-5-7-13(12)15-10-11(2)8-9-14(15)16/h4-5,7-10,12H,3,6H2,1-2H3 |
| InChIKey | KITPIGWWZIPYMC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one?
The IUPAC name of 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one (CID 118680503) is 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one.
What is the SMILES notation for 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one?
The canonical SMILES for 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one is CCC1CC=CC=C1n1cc(C)ccc1=O.
What is the InChIKey of 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one?
The InChIKey is KITPIGWWZIPYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-3-12-6-4-5-7-13(12)15-10-11(2)8-9-14(15)16/h4-5,7-10,12H,3,6H2,1-2H3.
What are the key properties of 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one?
1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one has a molecular weight of 215.30 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-ethylcyclohexa-1,3-dien-1-yl)-5-methylpyridin-2-one is sourced from PubChem (CID 118680503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).