About 4-methanimidoylcyclopenta-1,2,4-trien-1-amine
4-methanimidoylcyclopenta-1,2,4-trien-1-amine (PubChem CID 118682359) has the molecular formula C6H6N2
and a molecular weight of 106.13 g/mol. Its IUPAC name is 4-methanimidoylcyclopenta-1,2,4-trien-1-amine.
Molecular Properties
| Compound Name | 4-methanimidoylcyclopenta-1,2,4-trien-1-amine |
| PubChem CID | 118682359 |
| Molecular Formula | C6H6N2 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 4-methanimidoylcyclopenta-1,2,4-trien-1-amine |
| SMILES | [H]/N=C/C1=CC(N)=C=C1 |
| InChI | InChI=1S/C6H6N2/c7-4-5-1-2-6(8)3-5/h1,3-4,7H,8H2/b7-4+ |
| InChIKey | VNLMUAKPANKULQ-QPJJXVBHSA-N |
| XLogP | 0.57 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methanimidoylcyclopenta-1,2,4-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methanimidoylcyclopenta-1,2,4-trien-1-amine?
The IUPAC name of 4-methanimidoylcyclopenta-1,2,4-trien-1-amine (CID 118682359) is 4-methanimidoylcyclopenta-1,2,4-trien-1-amine.
What is the SMILES notation for 4-methanimidoylcyclopenta-1,2,4-trien-1-amine?
The canonical SMILES for 4-methanimidoylcyclopenta-1,2,4-trien-1-amine is [H]/N=C/C1=CC(N)=C=C1.
What is the InChIKey of 4-methanimidoylcyclopenta-1,2,4-trien-1-amine?
The InChIKey is VNLMUAKPANKULQ-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H6N2/c7-4-5-1-2-6(8)3-5/h1,3-4,7H,8H2/b7-4+.
What are the key properties of 4-methanimidoylcyclopenta-1,2,4-trien-1-amine?
4-methanimidoylcyclopenta-1,2,4-trien-1-amine has a molecular weight of 106.13 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methanimidoylcyclopenta-1,2,4-trien-1-amine is sourced from PubChem (CID 118682359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).