2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride

C3H6F2O5S2 — CID 118682784

IUPAC2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride
SMILESO=S(=O)(F)CCOCS(=O)(=O)F
InChIInChI=1S/C3H6F2O5S2/c4-11(6,7)2-1-10-3-12(5,8)9/h1-3H2
InChIKeyDVWKZWUSBUOSNQ-UHFFFAOYSA-N
MW224.21 g/mol
LogP-0.44
Rot. Bonds5

About 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride

2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride (PubChem CID 118682784) has the molecular formula C3H6F2O5S2 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride.

Molecular Properties

Compound Name2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride
PubChem CID118682784
Molecular FormulaC3H6F2O5S2
Molecular Weight224.21 g/mol
Exact Mass223.96
IUPAC Name2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride
SMILESO=S(=O)(F)CCOCS(=O)(=O)F
InChIInChI=1S/C3H6F2O5S2/c4-11(6,7)2-1-10-3-12(5,8)9/h1-3H2
InChIKeyDVWKZWUSBUOSNQ-UHFFFAOYSA-N
XLogP-0.44
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.21
LogP ≤ 5-0.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride?
The IUPAC name of 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride (CID 118682784) is 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride.
What is the SMILES notation for 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride?
The canonical SMILES for 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride is O=S(=O)(F)CCOCS(=O)(=O)F.
What is the InChIKey of 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride?
The InChIKey is DVWKZWUSBUOSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6F2O5S2/c4-11(6,7)2-1-10-3-12(5,8)9/h1-3H2.
What are the key properties of 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride?
2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride has a molecular weight of 224.21 g/mol, XLogP of -0.44, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluorosulfonylmethoxy)ethanesulfonyl fluoride is sourced from PubChem (CID 118682784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).