About N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide
N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide (PubChem CID 118682787) has the molecular formula C21H37NO
and a molecular weight of 319.53 g/mol. Its IUPAC name is N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide |
| PubChem CID | 118682787 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide |
| SMILES | CC(C)CCCCCCCCCCCCNC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C21H37NO/c1-19(2)15-11-9-7-5-3-4-6-8-10-14-18-22-21(23)20-16-12-13-17-20/h12-13,16,19H,3-11,14-15,17-18H2,1-2H3,(H,22,23) |
| InChIKey | YFSWSRDQMFTHGL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide?
The IUPAC name of N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide (CID 118682787) is N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide.
What is the SMILES notation for N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide?
The canonical SMILES for N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide is CC(C)CCCCCCCCCCCCNC(=O)C1=CC=CC1.
What is the InChIKey of N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide?
The InChIKey is YFSWSRDQMFTHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37NO/c1-19(2)15-11-9-7-5-3-4-6-8-10-14-18-22-21(23)20-16-12-13-17-20/h12-13,16,19H,3-11,14-15,17-18H2,1-2H3,(H,22,23).
What are the key properties of N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide?
N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide has a molecular weight of 319.53 g/mol, XLogP of 5.94, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(13-methyltetradecyl)cyclopenta-1,3-diene-1-carboxamide is sourced from PubChem (CID 118682787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).