C14H24N2O2 — CID 11868322
N-[(1S,2S,3S,4R)-3-acetamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 11868322) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[(1S,2S,3S,4R)-3-acetamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | N-[(1S,2S,3S,4R)-3-acetamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 11868322 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-[(1S,2S,3S,4R)-3-acetamido-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H]2CC[C@@](C)([C@@H]1NC(C)=O)C2(C)C |
| InChI | InChI=1S/C14H24N2O2/c1-8(17)15-11-10-6-7-14(5,13(10,3)4)12(11)16-9(2)18/h10-12H,6-7H2,1-5H3,(H,15,17)(H,16,18)/t10-,11+,12-,14+/m1/s1 |
| InChIKey | AMMHVWRMJVTZOQ-CZXHOFHRSA-N |
| XLogP | 1.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |