C25H21ClFN5O3 — CID 118683387
1-[(4-chlorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N,N-dimethyl-6-oxopyrimidine-5-carboxamide (PubChem CID 118683387) has the molecular formula C25H21ClFN5O3 and a molecular weight of 493.93 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N,N-dimethyl-6-oxopyrimidine-5-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N,N-dimethyl-6-oxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118683387 |
| Molecular Formula | C25H21ClFN5O3 |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N,N-dimethyl-6-oxopyrimidine-5-carboxamide |
| SMILES | CN(C)C(=O)c1cnc(Nc2ccc(Oc3cccc(F)n3)cc2)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C25H21ClFN5O3/c1-31(2)23(33)20-14-28-25(32(24(20)34)15-16-6-8-17(26)9-7-16)29-18-10-12-19(13-11-18)35-22-5-3-4-21(27)30-22/h3-14H,15H2,1-2H3,(H,28,29) |
| InChIKey | AYPYCROYPQJHTN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|