C12H22N4O2 — CID 11868339
N-methyl-N-[(1S,2S,3R,4R)-1,7,7-trimethyl-3-[methyl(nitroso)amino]-2-bicyclo[2.2.1]heptanyl]nitrous amide (PubChem CID 11868339) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-methyl-N-[(1S,2S,3R,4R)-1,7,7-trimethyl-3-[methyl(nitroso)amino]-2-bicyclo[2.2.1]heptanyl]nitrous amide.
| Compound Name | N-methyl-N-[(1S,2S,3R,4R)-1,7,7-trimethyl-3-[methyl(nitroso)amino]-2-bicyclo[2.2.1]heptanyl]nitrous amide |
|---|---|
| PubChem CID | 11868339 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-methyl-N-[(1S,2S,3R,4R)-1,7,7-trimethyl-3-[methyl(nitroso)amino]-2-bicyclo[2.2.1]heptanyl]nitrous amide |
| SMILES | CN(N=O)[C@@H]1[C@@H]2CC[C@](C)([C@@H]1N(C)N=O)C2(C)C |
| InChI | InChI=1S/C12H22N4O2/c1-11(2)8-6-7-12(11,3)10(16(5)14-18)9(8)15(4)13-17/h8-10H,6-7H2,1-5H3/t8-,9+,10+,12+/m0/s1 |
| InChIKey | DAGFXDCORKCKGU-BTQIBKBOSA-N |
| XLogP | 2.41 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|