C28H24F3N5O4 — CID 118683493
1-[(2,4-difluorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N-(oxan-4-yl)-4-oxopyrimidine-5-carboxamide (PubChem CID 118683493) has the molecular formula C28H24F3N5O4 and a molecular weight of 551.53 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N-(oxan-4-yl)-4-oxopyrimidine-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N-(oxan-4-yl)-4-oxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118683493 |
| Molecular Formula | C28H24F3N5O4 |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-2-[4-[(6-fluoro-2-pyridinyl)oxy]anilino]-N-(oxan-4-yl)-4-oxopyrimidine-5-carboxamide |
| SMILES | O=C(NC1CCOCC1)c1cn(Cc2ccc(F)cc2F)c(Nc2ccc(Oc3cccc(F)n3)cc2)nc1=O |
| InChI | InChI=1S/C28H24F3N5O4/c29-18-5-4-17(23(30)14-18)15-36-16-22(26(37)32-20-10-12-39-13-11-20)27(38)35-28(36)33-19-6-8-21(9-7-19)40-25-3-1-2-24(31)34-25/h1-9,14,16,20H,10-13,15H2,(H,32,37)(H,33,35,38) |
| InChIKey | MZASAQIJPSBAMG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|