C17H21BrO2 — CID 11868358
(1S,4S,5R)-4-[(R)-bromo(phenyl)methyl]-1,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one (PubChem CID 11868358) has the molecular formula C17H21BrO2 and a molecular weight of 337.26 g/mol. Its IUPAC name is (1S,4S,5R)-4-[(R)-bromo(phenyl)methyl]-1,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one.
| Compound Name | (1S,4S,5R)-4-[(R)-bromo(phenyl)methyl]-1,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 11868358 |
| Molecular Formula | C17H21BrO2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (1S,4S,5R)-4-[(R)-bromo(phenyl)methyl]-1,8,8-trimethyl-3-oxabicyclo[3.2.1]octan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)O[C@@H]2[C@H](Br)c1ccccc1 |
| InChI | InChI=1S/C17H21BrO2/c1-16(2)12-9-10-17(16,3)15(19)20-14(12)13(18)11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3/t12-,13+,14-,17+/m0/s1 |
| InChIKey | QYWCYKSLJQCHDH-QDEZUTFSSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|