C14H17ClN2O3S — CID 118683798
(2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-4-chloro-2-ethyl-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 118683798) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-4-chloro-2-ethyl-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-4-chloro-2-ethyl-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118683798 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-4-chloro-2-ethyl-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CC[C@]1(CO)O[C@@H](c2csc3c(N)ccnc23)[C@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C14H17ClN2O3S/c1-2-14(6-18)13(19)9(15)11(20-14)7-5-21-12-8(16)3-4-17-10(7)12/h3-5,9,11,13,18-19H,2,6H2,1H3,(H2,16,17)/t9-,11-,13-,14+/m0/s1 |
| InChIKey | LFCRDNCTOJJJEI-DTCNJJKHSA-N |
| XLogP | 2.06 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|