C12H15FN5O12P3S — CID 118683804
[[(2R,3R,4R,5S)-2-azido-4-fluoro-3-hydroxy-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118683804) has the molecular formula C12H15FN5O12P3S and a molecular weight of 565.26 g/mol. Its IUPAC name is [[(2R,3R,4R,5S)-2-azido-4-fluoro-3-hydroxy-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5S)-2-azido-4-fluoro-3-hydroxy-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118683804 |
| Molecular Formula | C12H15FN5O12P3S |
| Molecular Weight | 565.26 g/mol |
| Exact Mass | 564.96 |
| IUPAC Name | [[(2R,3R,4R,5S)-2-azido-4-fluoro-3-hydroxy-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1ncnc2c([C@@H]3O[C@@](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)(N=[N+]=[N-])[C@@H](O)[C@H]3F)csc12 |
| InChI | InChI=1S/C12H15FN5O12P3S/c1-5-10-8(16-4-15-5)6(2-34-10)9-7(13)11(19)12(28-9,17-18-14)3-27-32(23,24)30-33(25,26)29-31(20,21)22/h2,4,7,9,11,19H,3H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)/t7-,9-,11-,12+/m0/s1 |
| InChIKey | QCPYDHWMYDJCQH-JMWNJNDNSA-N |
| XLogP | 2.12 |
| TPSA | 263.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|