C23H26FN6O7PS — CID 118683805
ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118683805) has the molecular formula C23H26FN6O7PS and a molecular weight of 580.54 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118683805 |
| Molecular Formula | C23H26FN6O7PS |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(7-aminothieno[3,2-b]pyridin-3-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](c2csc3c(N)ccnc23)[C@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H26FN6O7PS/c1-3-34-22(32)13(2)28-38(33,37-14-7-5-4-6-8-14)35-12-23(29-30-26)21(31)17(24)19(36-23)15-11-39-20-16(25)9-10-27-18(15)20/h4-11,13,17,19,21,31H,3,12H2,1-2H3,(H2,25,27)(H,28,33)/t13-,17-,19-,21-,23+,38?/m0/s1 |
| InChIKey | YMVURBMIJXTQGD-KBGPVIKCSA-N |
| XLogP | 4.40 |
| TPSA | 190.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|