C12H12FN5O3S — CID 118683808
(2R,3R,4R,5S)-2-azido-4-fluoro-2-(hydroxymethyl)-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-3-ol (PubChem CID 118683808) has the molecular formula C12H12FN5O3S and a molecular weight of 325.33 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-azido-4-fluoro-2-(hydroxymethyl)-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-2-azido-4-fluoro-2-(hydroxymethyl)-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 118683808 |
| Molecular Formula | C12H12FN5O3S |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2R,3R,4R,5S)-2-azido-4-fluoro-2-(hydroxymethyl)-5-(4-methylthieno[3,2-d]pyrimidin-7-yl)oxolan-3-ol |
| SMILES | Cc1ncnc2c([C@@H]3O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@H]3F)csc12 |
| InChI | InChI=1S/C12H12FN5O3S/c1-5-10-8(16-4-15-5)6(2-22-10)9-7(13)11(20)12(3-19,21-9)17-18-14/h2,4,7,9,11,19-20H,3H2,1H3/t7-,9-,11-,12+/m0/s1 |
| InChIKey | QHILGANMQAUXBY-JMWNJNDNSA-N |
| XLogP | 1.77 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|