C11H9F2NO3 — CID 118683884
(2R,3S)-2-(2,5-difluorophenyl)-3-nitro-3,4-dihydro-2H-pyran (PubChem CID 118683884) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is (2R,3S)-2-(2,5-difluorophenyl)-3-nitro-3,4-dihydro-2H-pyran.
| Compound Name | (2R,3S)-2-(2,5-difluorophenyl)-3-nitro-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118683884 |
| Molecular Formula | C11H9F2NO3 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (2R,3S)-2-(2,5-difluorophenyl)-3-nitro-3,4-dihydro-2H-pyran |
| SMILES | O=[N+]([O-])[C@H]1CC=CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C11H9F2NO3/c12-7-3-4-9(13)8(6-7)11-10(14(15)16)2-1-5-17-11/h1,3-6,10-11H,2H2/t10-,11+/m0/s1 |
| InChIKey | XVZBHXQSIKSEJX-WDEREUQCSA-N |
| XLogP | 2.59 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|