C32H36N2 — CID 118683930
(1S,2S)-N,N'-bis[(2,6-dimethylphenyl)methyl]-1,2-diphenylethane-1,2-diamine (PubChem CID 118683930) has the molecular formula C32H36N2 and a molecular weight of 448.65 g/mol. Its IUPAC name is (1S,2S)-N,N'-bis[(2,6-dimethylphenyl)methyl]-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1S,2S)-N,N'-bis[(2,6-dimethylphenyl)methyl]-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 118683930 |
| Molecular Formula | C32H36N2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | (1S,2S)-N,N'-bis[(2,6-dimethylphenyl)methyl]-1,2-diphenylethane-1,2-diamine |
| SMILES | Cc1cccc(C)c1CN[C@@H](c1ccccc1)[C@@H](NCc1c(C)cccc1C)c1ccccc1 |
| InChI | InChI=1S/C32H36N2/c1-23-13-11-14-24(2)29(23)21-33-31(27-17-7-5-8-18-27)32(28-19-9-6-10-20-28)34-22-30-25(3)15-12-16-26(30)4/h5-20,31-34H,21-22H2,1-4H3/t31-,32-/m0/s1 |
| InChIKey | SVWDRJANHWFNBA-ACHIHNKUSA-N |
| XLogP | 7.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |