C20H23N5O4S — CID 118684037
(10R)-4-(1H-indazol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 118684037) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is (10R)-4-(1H-indazol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10R)-4-(1H-indazol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 118684037 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (10R)-4-(1H-indazol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CC(C)(c1nc(-c2cccc3[nH]ncc23)nc2c1OC[C@H]1COCCN21)S(C)(=O)=O |
| InChI | InChI=1S/C20H23N5O4S/c1-20(2,30(3,26)27)17-16-19(25-7-8-28-10-12(25)11-29-16)23-18(22-17)13-5-4-6-15-14(13)9-21-24-15/h4-6,9,12H,7-8,10-11H2,1-3H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | RRGSLSCHRGOAET-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |