C22H22F3N3O2 — CID 118684195
(3aS,6aR)-N-[3-(1-hydroxyethenyl)-2-pyridinyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 118684195) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is (3aS,6aR)-N-[3-(1-hydroxyethenyl)-2-pyridinyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N-[3-(1-hydroxyethenyl)-2-pyridinyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118684195 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (3aS,6aR)-N-[3-(1-hydroxyethenyl)-2-pyridinyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | C=C(O)c1cccnc1NC(=O)N1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C22H22F3N3O2/c1-13(29)17-6-4-8-26-20(17)27-21(30)28-11-15-9-14(10-16(15)12-28)18-5-2-3-7-19(18)22(23,24)25/h2-8,14-16,29H,1,9-12H2,(H,26,27,30)/t14?,15-,16+ |
| InChIKey | OEXHDSAPYHAXBQ-MQVJKMGUSA-N |
| XLogP | 5.29 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|