C24H25F3N2O4S — CID 118684197
(3aS,6aR)-N-[2-(1-hydroxyethenyl)-4-methylsulfonylphenyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 118684197) has the molecular formula C24H25F3N2O4S and a molecular weight of 494.54 g/mol. Its IUPAC name is (3aS,6aR)-N-[2-(1-hydroxyethenyl)-4-methylsulfonylphenyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N-[2-(1-hydroxyethenyl)-4-methylsulfonylphenyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118684197 |
| Molecular Formula | C24H25F3N2O4S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (3aS,6aR)-N-[2-(1-hydroxyethenyl)-4-methylsulfonylphenyl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | C=C(O)c1cc(S(C)(=O)=O)ccc1NC(=O)N1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C24H25F3N2O4S/c1-14(30)20-11-18(34(2,32)33)7-8-22(20)28-23(31)29-12-16-9-15(10-17(16)13-29)19-5-3-4-6-21(19)24(25,26)27/h3-8,11,15-17,30H,1,9-10,12-13H2,2H3,(H,28,31)/t15?,16-,17+ |
| InChIKey | GYBFJZVNKDQZPU-ALOPSCKCSA-N |
| XLogP | 5.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|