About 3-methylbut-2-enyl sulfite
3-methylbut-2-enyl sulfite (PubChem CID 118684404) has the molecular formula C5H9O3S-
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-methylbut-2-enyl sulfite.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl sulfite |
| PubChem CID | 118684404 |
| Molecular Formula | C5H9O3S- |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 3-methylbut-2-enyl sulfite |
| SMILES | CC(C)=CCOS(=O)[O-] |
| InChI | InChI=1S/C5H10O3S/c1-5(2)3-4-8-9(6)7/h3H,4H2,1-2H3,(H,6,7)/p-1 |
| InChIKey | BRJBZWALZPTLDV-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl sulfite?
The IUPAC name of 3-methylbut-2-enyl sulfite (CID 118684404) is 3-methylbut-2-enyl sulfite.
What is the SMILES notation for 3-methylbut-2-enyl sulfite?
The canonical SMILES for 3-methylbut-2-enyl sulfite is CC(C)=CCOS(=O)[O-].
What is the InChIKey of 3-methylbut-2-enyl sulfite?
The InChIKey is BRJBZWALZPTLDV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O3S/c1-5(2)3-4-8-9(6)7/h3H,4H2,1-2H3,(H,6,7)/p-1.
What are the key properties of 3-methylbut-2-enyl sulfite?
3-methylbut-2-enyl sulfite has a molecular weight of 149.19 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl sulfite is sourced from PubChem (CID 118684404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).