C25H24F3N3O — CID 118685579
2,4-dimethyl-6-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-7H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 118685579) has the molecular formula C25H24F3N3O and a molecular weight of 439.48 g/mol. Its IUPAC name is 2,4-dimethyl-6-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-7H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 2,4-dimethyl-6-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-7H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118685579 |
| Molecular Formula | C25H24F3N3O |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2,4-dimethyl-6-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-7H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | Cc1nc2c(c(C)c1C#N)C=C(C(O)(c1c(C)c(C)c(C)c3c1ccn3C)C(F)(F)F)C2 |
| InChI | InChI=1S/C25H24F3N3O/c1-12-13(2)22(18-7-8-31(6)23(18)14(12)3)24(32,25(26,27)28)17-9-19-15(4)20(11-29)16(5)30-21(19)10-17/h7-9,32H,10H2,1-6H3 |
| InChIKey | NQHGARWNDCZIGX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |