C16H15F3N4O2 — CID 118686035
(9R)-4-[(2,4,5-trifluorophenyl)methylamino]-11-oxa-1,5,7-triazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one (PubChem CID 118686035) has the molecular formula C16H15F3N4O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is (9R)-4-[(2,4,5-trifluorophenyl)methylamino]-11-oxa-1,5,7-triazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one.
| Compound Name | (9R)-4-[(2,4,5-trifluorophenyl)methylamino]-11-oxa-1,5,7-triazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 118686035 |
| Molecular Formula | C16H15F3N4O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (9R)-4-[(2,4,5-trifluorophenyl)methylamino]-11-oxa-1,5,7-triazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1nc(NCc2cc(F)c(F)cc2F)cc2n1C[C@@H]1COCCN21 |
| InChI | InChI=1S/C16H15F3N4O2/c17-11-4-13(19)12(18)3-9(11)6-20-14-5-15-22-1-2-25-8-10(22)7-23(15)16(24)21-14/h3-5,10H,1-2,6-8H2,(H,20,21,24)/t10-/m1/s1 |
| InChIKey | WSDQVIDUANTTMJ-SNVBAGLBSA-N |
| XLogP | 1.49 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|