C32H36N6O11S — CID 118686105
[3,4-diacetyloxy-5-azido-6-[[7-azido-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 118686105) has the molecular formula C32H36N6O11S and a molecular weight of 712.74 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-azido-6-[[7-azido-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-azido-6-[[7-azido-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118686105 |
| Molecular Formula | C32H36N6O11S |
| Molecular Weight | 712.74 g/mol |
| Exact Mass | 712.22 |
| IUPAC Name | [3,4-diacetyloxy-5-azido-6-[[7-azido-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC2C(N=[N+]=[N-])C(Sc3ccc(C)cc3)OC3COC(c4ccccc4)OC32)C(N=[N+]=[N-])C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H36N6O11S/c1-16-10-12-21(13-11-16)50-32-25(36-38-34)29(27-23(47-32)15-43-30(48-27)20-8-6-5-7-9-20)49-31-24(35-37-33)28(45-19(4)41)26(44-18(3)40)22(46-31)14-42-17(2)39/h5-13,22-32H,14-15H2,1-4H3 |
| InChIKey | MHQQDLICYFRWTQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 222.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|