C16H16F2N4O — CID 118686313
(6S)-11-[(2,3-difluorophenyl)methylamino]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one (PubChem CID 118686313) has the molecular formula C16H16F2N4O and a molecular weight of 318.33 g/mol. Its IUPAC name is (6S)-11-[(2,3-difluorophenyl)methylamino]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one.
| Compound Name | (6S)-11-[(2,3-difluorophenyl)methylamino]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
|---|---|
| PubChem CID | 118686313 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (6S)-11-[(2,3-difluorophenyl)methylamino]-2,8,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),10-dien-9-one |
| SMILES | O=c1nc(NCc2cccc(F)c2F)cc2n1C[C@@H]1CCCN21 |
| InChI | InChI=1S/C16H16F2N4O/c17-12-5-1-3-10(15(12)18)8-19-13-7-14-21-6-2-4-11(21)9-22(14)16(23)20-13/h1,3,5,7,11H,2,4,6,8-9H2,(H,19,20,23)/t11-/m0/s1 |
| InChIKey | WERICSXOMGIMBN-NSHDSACASA-N |
| XLogP | 2.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |