C15H16N2O3 — CID 118686841
7-[(3E)-3-aminohexa-1,3,5-trien-2-yl]-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylic acid (PubChem CID 118686841) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 7-[(3E)-3-aminohexa-1,3,5-trien-2-yl]-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylic acid.
| Compound Name | 7-[(3E)-3-aminohexa-1,3,5-trien-2-yl]-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 118686841 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 7-[(3E)-3-aminohexa-1,3,5-trien-2-yl]-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylic acid |
| SMILES | C=C/C=C(/N)C(=C)c1cc2n(c(=O)c1)C(C(=O)O)CC2 |
| InChI | InChI=1S/C15H16N2O3/c1-3-4-12(16)9(2)10-7-11-5-6-13(15(19)20)17(11)14(18)8-10/h3-4,7-8,13H,1-2,5-6,16H2,(H,19,20)/b12-4+ |
| InChIKey | VRGJGBNZBOGJON-UUILKARUSA-N |
| XLogP | 1.46 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|