C26H22F4O — CID 118687153
5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene (PubChem CID 118687153) has the molecular formula C26H22F4O and a molecular weight of 426.45 g/mol. Its IUPAC name is 5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 118687153 |
| Molecular Formula | C26H22F4O |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene |
| SMILES | CCCC1Cc2ccc(-c3ccc(-c4cc(F)c(OC=C(F)F)c(F)c4)cc3)cc2C1 |
| InChI | InChI=1S/C26H22F4O/c1-2-3-16-10-19-8-9-20(12-21(19)11-16)17-4-6-18(7-5-17)22-13-23(27)26(24(28)14-22)31-15-25(29)30/h4-9,12-16H,2-3,10-11H2,1H3 |
| InChIKey | PPZWVNWZLZBBQO-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|