C25H19F5O — CID 118687159
5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]-3-fluorophenyl]-2-ethyl-2,3-dihydro-1H-indene (PubChem CID 118687159) has the molecular formula C25H19F5O and a molecular weight of 430.42 g/mol. Its IUPAC name is 5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]-3-fluorophenyl]-2-ethyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]-3-fluorophenyl]-2-ethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 118687159 |
| Molecular Formula | C25H19F5O |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 5-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]-3-fluorophenyl]-2-ethyl-2,3-dihydro-1H-indene |
| SMILES | CCC1Cc2ccc(-c3ccc(-c4cc(F)c(OC=C(F)F)c(F)c4)c(F)c3)cc2C1 |
| InChI | InChI=1S/C25H19F5O/c1-2-14-7-15-3-4-16(9-18(15)8-14)17-5-6-20(21(26)10-17)19-11-22(27)25(23(28)12-19)31-13-24(29)30/h3-6,9-14H,2,7-8H2,1H3 |
| InChIKey | GXOJRPXLRSOKKU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|