C21H29O3- — CID 11868748
2-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetate (PubChem CID 11868748) has the molecular formula C21H29O3- and a molecular weight of 329.46 g/mol. Its IUPAC name is 2-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetate.
| Compound Name | 2-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetate |
|---|---|
| PubChem CID | 11868748 |
| Molecular Formula | C21H29O3- |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetate |
| SMILES | C[C@]12CC=C(CC(=O)[O-])C[C@@H]1CC[C@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O3/c1-20-9-7-13(12-19(23)24)11-14(20)3-4-15-16-5-6-18(22)21(16,2)10-8-17(15)20/h7,14-17H,3-6,8-12H2,1-2H3,(H,23,24)/p-1/t14-,15+,16-,17-,20-,21-/m0/s1 |
| InChIKey | ZMIHCYKKQDEVNI-FMZZOXHWSA-M |
| XLogP | 3.27 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|