About 2,2,2-trifluoroethyl 2-sulfooxypropanoate
2,2,2-trifluoroethyl 2-sulfooxypropanoate (PubChem CID 118687555) has the molecular formula C5H7F3O6S
and a molecular weight of 252.17 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-sulfooxypropanoate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl 2-sulfooxypropanoate |
| PubChem CID | 118687555 |
| Molecular Formula | C5H7F3O6S |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-sulfooxypropanoate |
| SMILES | CC(OS(=O)(=O)O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C5H7F3O6S/c1-3(14-15(10,11)12)4(9)13-2-5(6,7)8/h3H,2H2,1H3,(H,10,11,12) |
| InChIKey | HZFPTNWBTIAQPN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl 2-sulfooxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2-sulfooxypropanoate?
The IUPAC name of 2,2,2-trifluoroethyl 2-sulfooxypropanoate (CID 118687555) is 2,2,2-trifluoroethyl 2-sulfooxypropanoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-sulfooxypropanoate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-sulfooxypropanoate is CC(OS(=O)(=O)O)C(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl 2-sulfooxypropanoate?
The InChIKey is HZFPTNWBTIAQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3O6S/c1-3(14-15(10,11)12)4(9)13-2-5(6,7)8/h3H,2H2,1H3,(H,10,11,12).
What are the key properties of 2,2,2-trifluoroethyl 2-sulfooxypropanoate?
2,2,2-trifluoroethyl 2-sulfooxypropanoate has a molecular weight of 252.17 g/mol, XLogP of 0.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-sulfooxypropanoate is sourced from PubChem (CID 118687555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).