C29H25F6N2PS — CID 118687811
3-[3,5-bis(trifluoromethyl)phenyl]-1-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-1-methylthiourea (PubChem CID 118687811) has the molecular formula C29H25F6N2PS and a molecular weight of 578.56 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-1-methylthiourea.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-1-methylthiourea |
|---|---|
| PubChem CID | 118687811 |
| Molecular Formula | C29H25F6N2PS |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-1-methylthiourea |
| SMILES | C[C@@H](C1=C(P(c2ccccc2)c2ccccc2)CC=C1)N(C)C(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H25F6N2PS/c1-19(37(2)27(39)36-22-17-20(28(30,31)32)16-21(18-22)29(33,34)35)25-14-9-15-26(25)38(23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-14,16-19H,15H2,1-2H3,(H,36,39)/t19-/m0/s1 |
| InChIKey | VJJHFCZZLGFHQM-IBGZPJMESA-N |
| XLogP | 8.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|