C25H33O3- — CID 11868782
2-[(8R,9S,10R,13S,14R,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-2-methylpropanoate (PubChem CID 11868782) has the molecular formula C25H33O3- and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14R,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-2-methylpropanoate.
| Compound Name | 2-[(8R,9S,10R,13S,14R,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 11868782 |
| Molecular Formula | C25H33O3- |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14R,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]-2-methylpropanoate |
| SMILES | C#C[C@]1(O)CC[C@@H]2[C@@H]3CC=C4C=C(C(C)(C)C(=O)[O-])CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H34O3/c1-6-25(28)14-11-20-18-8-7-17-15-16(22(2,3)21(26)27)9-12-23(17,4)19(18)10-13-24(20,25)5/h1,7,15,18-20,28H,8-14H2,2-5H3,(H,26,27)/p-1/t18-,19+,20-,23+,24+,25+/m1/s1 |
| InChIKey | NFVZMTPMHRVCTP-CIPHDHMHSA-M |
| XLogP | 3.63 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|