C37H38N3PS — CID 118687971
1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[diphenyl(pyrrolidin-2-yl)methyl]thiourea (PubChem CID 118687971) has the molecular formula C37H38N3PS and a molecular weight of 587.77 g/mol. Its IUPAC name is 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[diphenyl(pyrrolidin-2-yl)methyl]thiourea.
| Compound Name | 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[diphenyl(pyrrolidin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 118687971 |
| Molecular Formula | C37H38N3PS |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[diphenyl(pyrrolidin-2-yl)methyl]thiourea |
| SMILES | C[C@@H](NC(=S)NC(c1ccccc1)(c1ccccc1)C1CCCN1)C1=C(P(c2ccccc2)c2ccccc2)C=CC1 |
| InChI | InChI=1S/C37H38N3PS/c1-28(33-24-14-25-34(33)41(31-20-10-4-11-21-31)32-22-12-5-13-23-32)39-36(42)40-37(35-26-15-27-38-35,29-16-6-2-7-17-29)30-18-8-3-9-19-30/h2-14,16-23,25,28,35,38H,15,24,26-27H2,1H3,(H2,39,40,42)/t28-,35?/m1/s1 |
| InChIKey | BDSONTLEZLKPHJ-SEZSJYDQSA-N |
| XLogP | 6.88 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|