C21H30O4 — CID 11868825
(5R,8S,9S,10S,13S,14R)-10,13-dimethylspiro[1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3,17-dione (PubChem CID 11868825) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (5R,8S,9S,10S,13S,14R)-10,13-dimethylspiro[1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3,17-dione.
| Compound Name | (5R,8S,9S,10S,13S,14R)-10,13-dimethylspiro[1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3,17-dione |
|---|---|
| PubChem CID | 11868825 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (5R,8S,9S,10S,13S,14R)-10,13-dimethylspiro[1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3,17-dione |
| SMILES | C[C@]12CCC(=O)C[C@@H]1CC1(OCCO1)[C@@H]1[C@H]3CCC(=O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O4/c1-19-7-5-14(22)11-13(19)12-21(24-9-10-25-21)18-15-3-4-17(23)20(15,2)8-6-16(18)19/h13,15-16,18H,3-12H2,1-2H3/t13-,15-,16+,18-,19+,20+/m1/s1 |
| InChIKey | AESLIOMWUFZQOI-OGTXFPKISA-N |
| XLogP | 3.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |