About tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate
tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate (PubChem CID 118689352) has the molecular formula C14H28N4O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate |
| PubChem CID | 118689352 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate |
| SMILES | CCCN(CCCNC(=O)OC(C)(C)C)C1=NCCN1 |
| InChI | InChI=1S/C14H28N4O2/c1-5-10-18(12-15-8-9-16-12)11-6-7-17-13(19)20-14(2,3)4/h5-11H2,1-4H3,(H,15,16)(H,17,19) |
| InChIKey | RJBNRYDWERBZCA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate?
The IUPAC name of tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate (CID 118689352) is tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate.
What is the SMILES notation for tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate?
The canonical SMILES for tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate is CCCN(CCCNC(=O)OC(C)(C)C)C1=NCCN1.
What is the InChIKey of tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate?
The InChIKey is RJBNRYDWERBZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O2/c1-5-10-18(12-15-8-9-16-12)11-6-7-17-13(19)20-14(2,3)4/h5-11H2,1-4H3,(H,15,16)(H,17,19).
What are the key properties of tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate?
tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate has a molecular weight of 284.40 g/mol, XLogP of 1.57, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-[4,5-dihydro-1H-imidazol-2-yl(propyl)amino]propyl]carbamate is sourced from PubChem (CID 118689352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).