About 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one
1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 118689466) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| PubChem CID | 118689466 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | COc1cccc(OC)c1/C=C/C(=O)N1CCC=CC1=O |
| InChI | InChI=1S/C16H17NO4/c1-20-13-6-5-7-14(21-2)12(13)9-10-16(19)17-11-4-3-8-15(17)18/h3,5-10H,4,11H2,1-2H3/b10-9+ |
| InChIKey | XKDUUINNYPNOPK-MDZDMXLPSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
The IUPAC name of 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one (CID 118689466) is 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one is COc1cccc(OC)c1/C=C/C(=O)N1CCC=CC1=O.
What is the InChIKey of 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
The InChIKey is XKDUUINNYPNOPK-MDZDMXLPSA-N. The full InChI is InChI=1S/C16H17NO4/c1-20-13-6-5-7-14(21-2)12(13)9-10-16(19)17-11-4-3-8-15(17)18/h3,5-10H,4,11H2,1-2H3/b10-9+.
What are the key properties of 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one has a molecular weight of 287.32 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one is sourced from PubChem (CID 118689466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).