About 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one
1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 118689467) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| PubChem CID | 118689467 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC=CC2=O)cc1N |
| InChI | InChI=1S/C15H16N2O3/c1-20-13-7-5-11(10-12(13)16)6-8-15(19)17-9-3-2-4-14(17)18/h2,4-8,10H,3,9,16H2,1H3/b8-6+ |
| InChIKey | BOHLMPSEEYXLMS-SOFGYWHQSA-N |
| XLogP | 1.61 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
The IUPAC name of 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one (CID 118689467) is 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one is COc1ccc(/C=C/C(=O)N2CCC=CC2=O)cc1N.
What is the InChIKey of 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
The InChIKey is BOHLMPSEEYXLMS-SOFGYWHQSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-20-13-7-5-11(10-12(13)16)6-8-15(19)17-9-3-2-4-14(17)18/h2,4-8,10H,3,9,16H2,1H3/b8-6+.
What are the key properties of 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one?
1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one has a molecular weight of 272.30 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-(3-amino-4-methoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one is sourced from PubChem (CID 118689467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).