About (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione
(3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione (PubChem CID 118689522) has the molecular formula C5H4INO3
and a molecular weight of 252.99 g/mol. Its IUPAC name is (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione.
Molecular Properties
| Compound Name | (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione |
| PubChem CID | 118689522 |
| Molecular Formula | C5H4INO3 |
| Molecular Weight | 252.99 g/mol |
| Exact Mass | 252.92 |
| IUPAC Name | (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione |
| SMILES | O=C1CN(I)C(=O)/C1=C\O |
| InChI | InChI=1S/C5H4INO3/c6-7-1-4(9)3(2-8)5(7)10/h2,8H,1H2/b3-2- |
| InChIKey | SDJMZAWZBUKZPJ-IHWYPQMZSA-N |
| XLogP | 0.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.99 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione?
The IUPAC name of (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione (CID 118689522) is (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione.
What is the SMILES notation for (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione?
The canonical SMILES for (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione is O=C1CN(I)C(=O)/C1=C\O.
What is the InChIKey of (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione?
The InChIKey is SDJMZAWZBUKZPJ-IHWYPQMZSA-N. The full InChI is InChI=1S/C5H4INO3/c6-7-1-4(9)3(2-8)5(7)10/h2,8H,1H2/b3-2-.
What are the key properties of (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione?
(3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione has a molecular weight of 252.99 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(hydroxymethylidene)-1-iodopyrrolidine-2,4-dione is sourced from PubChem (CID 118689522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).