C16H21NO6 — CID 118689684
(2S)-1-[(2S)-2-(3,4,5-trihydroxyphenyl)butanoyl]piperidine-2-carboxylic acid (PubChem CID 118689684) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(3,4,5-trihydroxyphenyl)butanoyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-(3,4,5-trihydroxyphenyl)butanoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118689684 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2S)-1-[(2S)-2-(3,4,5-trihydroxyphenyl)butanoyl]piperidine-2-carboxylic acid |
| SMILES | CC[C@H](C(=O)N1CCCC[C@H]1C(=O)O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C16H21NO6/c1-2-10(9-7-12(18)14(20)13(19)8-9)15(21)17-6-4-3-5-11(17)16(22)23/h7-8,10-11,18-20H,2-6H2,1H3,(H,22,23)/t10-,11-/m0/s1 |
| InChIKey | SWIWRXUIAXRWIR-QWRGUYRKSA-N |
| XLogP | 1.76 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|