About (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol
(1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol (PubChem CID 118689701) has the molecular formula C15H16Cl2N2O
and a molecular weight of 311.21 g/mol. Its IUPAC name is (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol.
Molecular Properties
| Compound Name | (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol |
| PubChem CID | 118689701 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol |
| SMILES | CNC[C@H](c1ccc(Cl)c(Cl)c1)[C@H](O)c1ccncc1 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-18-9-12(11-2-3-13(16)14(17)8-11)15(20)10-4-6-19-7-5-10/h2-8,12,15,18,20H,9H2,1H3/t12-,15-/m1/s1 |
| InChIKey | NPWAETAHTCVZBJ-IUODEOHRSA-N |
| XLogP | 3.42 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol?
The IUPAC name of (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol (CID 118689701) is (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol.
What is the SMILES notation for (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol?
The canonical SMILES for (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol is CNC[C@H](c1ccc(Cl)c(Cl)c1)[C@H](O)c1ccncc1.
What is the InChIKey of (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol?
The InChIKey is NPWAETAHTCVZBJ-IUODEOHRSA-N. The full InChI is InChI=1S/C15H16Cl2N2O/c1-18-9-12(11-2-3-13(16)14(17)8-11)15(20)10-4-6-19-7-5-10/h2-8,12,15,18,20H,9H2,1H3/t12-,15-/m1/s1.
What are the key properties of (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol?
(1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol has a molecular weight of 311.21 g/mol, XLogP of 3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-(3,4-dichlorophenyl)-3-(methylamino)-1-pyridin-4-ylpropan-1-ol is sourced from PubChem (CID 118689701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).