About N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine
N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine (PubChem CID 118689751) has the molecular formula C9H20N4
and a molecular weight of 184.29 g/mol. Its IUPAC name is N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine |
| PubChem CID | 118689751 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CCCN)C1=NCCN1 |
| InChI | InChI=1S/C9H20N4/c1-2-7-13(8-3-4-10)9-11-5-6-12-9/h2-8,10H2,1H3,(H,11,12) |
| InChIKey | AYJAYMYSZJVBJM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine?
The IUPAC name of N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine (CID 118689751) is N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine?
The canonical SMILES for N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine is CCCN(CCCN)C1=NCCN1.
What is the InChIKey of N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine?
The InChIKey is AYJAYMYSZJVBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4/c1-2-7-13(8-3-4-10)9-11-5-6-12-9/h2-8,10H2,1H3,(H,11,12).
What are the key properties of N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine?
N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine has a molecular weight of 184.29 g/mol, XLogP of 0.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,5-dihydro-1H-imidazol-2-yl)-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 118689751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).