About 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide
2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide (PubChem CID 118690450) has the molecular formula C8H11F3N2O
and a molecular weight of 208.18 g/mol. Its IUPAC name is 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide |
| PubChem CID | 118690450 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(NC(=O)CC#N)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O/c1-5(2)7(8(9,10)11)13-6(14)3-4-12/h5,7H,3H2,1-2H3,(H,13,14) |
| InChIKey | RRDOAAQMWJFNMN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide?
The IUPAC name of 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide (CID 118690450) is 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide.
What is the SMILES notation for 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide?
The canonical SMILES for 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide is CC(C)C(NC(=O)CC#N)C(F)(F)F.
What is the InChIKey of 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide?
The InChIKey is RRDOAAQMWJFNMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O/c1-5(2)7(8(9,10)11)13-6(14)3-4-12/h5,7H,3H2,1-2H3,(H,13,14).
What are the key properties of 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide?
2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide has a molecular weight of 208.18 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(1,1,1-trifluoro-3-methylbutan-2-yl)acetamide is sourced from PubChem (CID 118690450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).