C24H35O6-3 — CID 11869049
(1R,3aR,4R,5S,7aR)-1-[(2S)-4-carboxylatobutan-2-yl]-5-[(1R,2R)-2-carboxylato-1-methylcyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate (PubChem CID 11869049) has the molecular formula C24H35O6-3 and a molecular weight of 419.54 g/mol. Its IUPAC name is (1R,3aR,4R,5S,7aR)-1-[(2S)-4-carboxylatobutan-2-yl]-5-[(1R,2R)-2-carboxylato-1-methylcyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate.
| Compound Name | (1R,3aR,4R,5S,7aR)-1-[(2S)-4-carboxylatobutan-2-yl]-5-[(1R,2R)-2-carboxylato-1-methylcyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 11869049 |
| Molecular Formula | C24H35O6-3 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (1R,3aR,4R,5S,7aR)-1-[(2S)-4-carboxylatobutan-2-yl]-5-[(1R,2R)-2-carboxylato-1-methylcyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
| SMILES | C[C@@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@H](C(=O)[O-])[C@@H]([C@@]3(C)CCCC[C@H]3C(=O)[O-])CC[C@@]21C |
| InChI | InChI=1S/C24H38O6/c1-14(7-10-19(25)26)15-8-9-16-20(22(29)30)17(11-13-24(15,16)3)23(2)12-5-4-6-18(23)21(27)28/h14-18,20H,4-13H2,1-3H3,(H,25,26)(H,27,28)(H,29,30)/p-3/t14-,15+,16+,17-,18-,20+,23+,24+/m0/s1 |
| InChIKey | BWPVHESSENIYDR-CDXCUEADSA-K |
| XLogP | 0.91 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |