About 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one
6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one (PubChem CID 118690760) has the molecular formula C22H19N5O4
and a molecular weight of 417.43 g/mol. Its IUPAC name is 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one |
| PubChem CID | 118690760 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one |
| SMILES | O=c1cc(N2CCOCC2)[nH]c2ccc(-c3cn(-c4ccc5c(c4)OCO5)nn3)cc12 |
| InChI | InChI=1S/C22H19N5O4/c28-19-11-22(26-5-7-29-8-6-26)23-17-3-1-14(9-16(17)19)18-12-27(25-24-18)15-2-4-20-21(10-15)31-13-30-20/h1-4,9-12H,5-8,13H2,(H,23,28) |
| InChIKey | IKAKJALYNJCABH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one?
The IUPAC name of 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one (CID 118690760) is 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one.
What is the SMILES notation for 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one?
The canonical SMILES for 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one is O=c1cc(N2CCOCC2)[nH]c2ccc(-c3cn(-c4ccc5c(c4)OCO5)nn3)cc12.
What is the InChIKey of 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one?
The InChIKey is IKAKJALYNJCABH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O4/c28-19-11-22(26-5-7-29-8-6-26)23-17-3-1-14(9-16(17)19)18-12-27(25-24-18)15-2-4-20-21(10-15)31-13-30-20/h1-4,9-12H,5-8,13H2,(H,23,28).
What are the key properties of 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one?
6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one has a molecular weight of 417.43 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(1,3-benzodioxol-5-yl)triazol-4-yl]-2-morpholin-4-yl-1H-quinolin-4-one is sourced from PubChem (CID 118690760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).