About N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide
N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide (PubChem CID 118690967) has the molecular formula C19H16FNO2
and a molecular weight of 309.34 g/mol. Its IUPAC name is N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide.
Molecular Properties
| Compound Name | N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide |
| PubChem CID | 118690967 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide |
| SMILES | O=C(NC1=CCC(O)(c2ccccc2F)C=C1)c1ccccc1 |
| InChI | InChI=1S/C19H16FNO2/c20-17-9-5-4-8-16(17)19(23)12-10-15(11-13-19)21-18(22)14-6-2-1-3-7-14/h1-12,23H,13H2,(H,21,22) |
| InChIKey | JKOVFYDACHEJQH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide?
The IUPAC name of N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide (CID 118690967) is N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide.
What is the SMILES notation for N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide?
The canonical SMILES for N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide is O=C(NC1=CCC(O)(c2ccccc2F)C=C1)c1ccccc1.
What is the InChIKey of N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide?
The InChIKey is JKOVFYDACHEJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FNO2/c20-17-9-5-4-8-16(17)19(23)12-10-15(11-13-19)21-18(22)14-6-2-1-3-7-14/h1-12,23H,13H2,(H,21,22).
What are the key properties of N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide?
N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide has a molecular weight of 309.34 g/mol, XLogP of 3.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-fluorophenyl)-4-hydroxycyclohexa-1,5-dien-1-yl]benzamide is sourced from PubChem (CID 118690967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).