C25H34O4S — CID 118691076
[(3S,5S,6R,7R,8R,9S,10R,13S,14S)-6,7-dihydroxy-10,13-dimethyl-17-thiophen-2-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 118691076) has the molecular formula C25H34O4S and a molecular weight of 430.61 g/mol. Its IUPAC name is [(3S,5S,6R,7R,8R,9S,10R,13S,14S)-6,7-dihydroxy-10,13-dimethyl-17-thiophen-2-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,6R,7R,8R,9S,10R,13S,14S)-6,7-dihydroxy-10,13-dimethyl-17-thiophen-2-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 118691076 |
| Molecular Formula | C25H34O4S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [(3S,5S,6R,7R,8R,9S,10R,13S,14S)-6,7-dihydroxy-10,13-dimethyl-17-thiophen-2-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@H](C1)[C@@H](O)[C@H](O)[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccs3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H34O4S/c1-14(26)29-15-8-10-25(3)18-9-11-24(2)16(20-5-4-12-30-20)6-7-17(24)21(18)23(28)22(27)19(25)13-15/h4-6,12,15,17-19,21-23,27-28H,7-11,13H2,1-3H3/t15-,17-,18-,19+,21-,22+,23+,24+,25+/m0/s1 |
| InChIKey | GSNOPMUNGNGCLJ-LTINVPRTSA-N |
| XLogP | 4.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |