C12H22NO5+ — CID 11869124
[(1R,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylazanium (PubChem CID 11869124) has the molecular formula C12H22NO5+ and a molecular weight of 260.31 g/mol. Its IUPAC name is [(1R,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylazanium.
| Compound Name | [(1R,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylazanium |
|---|---|
| PubChem CID | 11869124 |
| Molecular Formula | C12H22NO5+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(1R,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylazanium |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](C[NH3+])O[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H21NO5/c1-11(2)15-7-6(5-13)14-10-9(8(7)16-11)17-12(3,4)18-10/h6-10H,5,13H2,1-4H3/p+1/t6-,7+,8-,9-,10+/m1/s1 |
| InChIKey | AVTBCTQHGBMWTA-ZOZBQHSOSA-O |
| XLogP | -0.38 |
| TPSA | 73.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |