About N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide
N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide (PubChem CID 118691310) has the molecular formula C11H17F3N2O2
and a molecular weight of 266.26 g/mol. Its IUPAC name is N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide.
Molecular Properties
| Compound Name | N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide |
| PubChem CID | 118691310 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide |
| SMILES | CCCC(=O)NN1CCC(CC(F)(F)F)CC1=O |
| InChI | InChI=1S/C11H17F3N2O2/c1-2-3-9(17)15-16-5-4-8(6-10(16)18)7-11(12,13)14/h8H,2-7H2,1H3,(H,15,17) |
| InChIKey | POQCOTLKPXNIBT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide?
The IUPAC name of N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide (CID 118691310) is N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide.
What is the SMILES notation for N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide?
The canonical SMILES for N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide is CCCC(=O)NN1CCC(CC(F)(F)F)CC1=O.
What is the InChIKey of N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide?
The InChIKey is POQCOTLKPXNIBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O2/c1-2-3-9(17)15-16-5-4-8(6-10(16)18)7-11(12,13)14/h8H,2-7H2,1H3,(H,15,17).
What are the key properties of N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide?
N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide has a molecular weight of 266.26 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-4-(2,2,2-trifluoroethyl)piperidin-1-yl]butanamide is sourced from PubChem (CID 118691310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).