C29H32FN5O5 — CID 118691321
3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[(2R,3S)-8-[2-(4-fluorophenyl)ethynyl]-5-(1-hydroxypropan-2-yl)-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea (PubChem CID 118691321) has the molecular formula C29H32FN5O5 and a molecular weight of 549.60 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[(2R,3S)-8-[2-(4-fluorophenyl)ethynyl]-5-(1-hydroxypropan-2-yl)-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[(2R,3S)-8-[2-(4-fluorophenyl)ethynyl]-5-(1-hydroxypropan-2-yl)-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 118691321 |
| Molecular Formula | C29H32FN5O5 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[(2R,3S)-8-[2-(4-fluorophenyl)ethynyl]-5-(1-hydroxypropan-2-yl)-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea |
| SMILES | Cc1noc(C)c1NC(=O)N(C)C[C@@H]1Oc2ncc(C#Cc3ccc(F)cc3)cc2C(=O)N(C(C)CO)C[C@@H]1C |
| InChI | InChI=1S/C29H32FN5O5/c1-17-14-35(18(2)16-36)28(37)24-12-22(7-6-21-8-10-23(30)11-9-21)13-31-27(24)39-25(17)15-34(5)29(38)32-26-19(3)33-40-20(26)4/h8-13,17-18,25,36H,14-16H2,1-5H3,(H,32,38)/t17-,18?,25-/m0/s1 |
| InChIKey | AQGCRWSKQDYQQA-NNKBYCLSSA-N |
| XLogP | 3.61 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|