About 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid
1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid (PubChem CID 118691419) has the molecular formula C29H28FN3O4
and a molecular weight of 501.56 g/mol. Its IUPAC name is 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid |
| PubChem CID | 118691419 |
| Molecular Formula | C29H28FN3O4 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(CCn2c(=O)c3ccccc3n(Cc3ccccc3)c2=O)CCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C29H28FN3O4/c30-22-12-10-21(11-13-22)23-14-15-31(19-25(23)28(35)36)16-17-32-27(34)24-8-4-5-9-26(24)33(29(32)37)18-20-6-2-1-3-7-20/h1-13,23,25H,14-19H2,(H,35,36) |
| InChIKey | QKDOANYSGRDTNN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid (CID 118691419) is 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid is O=C(O)C1CN(CCn2c(=O)c3ccccc3n(Cc3ccccc3)c2=O)CCC1c1ccc(F)cc1.
What is the InChIKey of 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid?
The InChIKey is QKDOANYSGRDTNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28FN3O4/c30-22-12-10-21(11-13-22)23-14-15-31(19-25(23)28(35)36)16-17-32-27(34)24-8-4-5-9-26(24)33(29(32)37)18-20-6-2-1-3-7-20/h1-13,23,25H,14-19H2,(H,35,36).
What are the key properties of 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid?
1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid has a molecular weight of 501.56 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-benzyl-2,4-dioxoquinazolin-3-yl)ethyl]-4-(4-fluorophenyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 118691419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).