C22H23N6O4+ — CID 118691526
[3-[3-carboxy-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]piperidin-4-yl]phenyl]imino-iminoazanium (PubChem CID 118691526) has the molecular formula C22H23N6O4+ and a molecular weight of 435.46 g/mol. Its IUPAC name is [3-[3-carboxy-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]piperidin-4-yl]phenyl]imino-iminoazanium.
| Compound Name | [3-[3-carboxy-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]piperidin-4-yl]phenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 118691526 |
| Molecular Formula | C22H23N6O4+ |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [3-[3-carboxy-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]piperidin-4-yl]phenyl]imino-iminoazanium |
| SMILES | N=[N+]=Nc1cccc(C2CCN(CCn3c(=O)[nH]c4ccccc4c3=O)CC2C(=O)O)c1 |
| InChI | InChI=1S/C22H22N6O4/c23-26-25-15-5-3-4-14(12-15)16-8-9-27(13-18(16)21(30)31)10-11-28-20(29)17-6-1-2-7-19(17)24-22(28)32/h1-7,12,16,18,23H,8-11,13H2,(H-,24,29,30,31,32)/p+1 |
| InChIKey | ISHCTMURUREACK-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|