C7H8N2 — CID 11869173
(1R,2R,6S)-3,4-diazatricyclo[4.2.1.02,5]nona-3,7-diene (PubChem CID 11869173) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is (1R,2R,6S)-3,4-diazatricyclo[4.2.1.02,5]nona-3,7-diene.
| Compound Name | (1R,2R,6S)-3,4-diazatricyclo[4.2.1.02,5]nona-3,7-diene |
|---|---|
| PubChem CID | 11869173 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | (1R,2R,6S)-3,4-diazatricyclo[4.2.1.02,5]nona-3,7-diene |
| SMILES | C1=C[C@H]2C[C@@H]1C1N=N[C@@H]12 |
| InChI | InChI=1S/C7H8N2/c1-2-5-3-4(1)6-7(5)9-8-6/h1-2,4-7H,3H2/t4-,5+,6+,7?/m0/s1 |
| InChIKey | UNSPTTVDHBABCW-CUWOBHIPSA-N |
| XLogP | 1.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|